About zinc;hept-2-enoic acid;oxygen(2-)
zinc;hept-2-enoic acid;oxygen(2-) (PubChem CID 160568459) has the molecular formula C7H12O3Zn
and a molecular weight of 209.56 g/mol. Its IUPAC name is zinc;hept-2-enoic acid;oxygen(2-).
Molecular Properties
| Compound Name | zinc;hept-2-enoic acid;oxygen(2-) |
| PubChem CID | 160568459 |
| Molecular Formula | C7H12O3Zn |
| Molecular Weight | 209.56 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | zinc;hept-2-enoic acid;oxygen(2-) |
| SMILES | CCCCC=CC(=O)O.[O-2].[Zn+2] |
| InChI | InChI=1S/C7H12O2.O.Zn/c1-2-3-4-5-6-7(8)9;;/h5-6H,2-4H2,1H3,(H,8,9);;/q;-2;+2 |
| InChIKey | JPQXPEVWJACVBR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 65.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.56 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;hept-2-enoic acid;oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;hept-2-enoic acid;oxygen(2-)?
The IUPAC name of zinc;hept-2-enoic acid;oxygen(2-) (CID 160568459) is zinc;hept-2-enoic acid;oxygen(2-).
What is the SMILES notation for zinc;hept-2-enoic acid;oxygen(2-)?
The canonical SMILES for zinc;hept-2-enoic acid;oxygen(2-) is CCCCC=CC(=O)O.[O-2].[Zn+2].
What is the InChIKey of zinc;hept-2-enoic acid;oxygen(2-)?
The InChIKey is JPQXPEVWJACVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.O.Zn/c1-2-3-4-5-6-7(8)9;;/h5-6H,2-4H2,1H3,(H,8,9);;/q;-2;+2.
What are the key properties of zinc;hept-2-enoic acid;oxygen(2-)?
zinc;hept-2-enoic acid;oxygen(2-) has a molecular weight of 209.56 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;hept-2-enoic acid;oxygen(2-) is sourced from PubChem (CID 160568459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).