cyclopentane;(E)-hept-2-enoic acid

C12H22O2 — CID 66887361

IUPACcyclopentane;(E)-hept-2-enoic acid
SMILESC1CCCC1.CCCC/C=C/C(=O)O
InChIInChI=1S/C7H12O2.C5H10/c1-2-3-4-5-6-7(8)9;1-2-4-5-3-1/h5-6H,2-4H2,1H3,(H,8,9);1-5H2/b6-5+;
InChIKeyHYHRQSRVNNJKDC-IPZCTEOASA-N
MW198.31 g/mol
LogP3.77
Rot. Bonds4

About cyclopentane;(E)-hept-2-enoic acid

cyclopentane;(E)-hept-2-enoic acid (PubChem CID 66887361) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is cyclopentane;(E)-hept-2-enoic acid.

Molecular Properties

Compound Namecyclopentane;(E)-hept-2-enoic acid
PubChem CID66887361
Molecular FormulaC12H22O2
Molecular Weight198.31 g/mol
Exact Mass198.16
IUPAC Namecyclopentane;(E)-hept-2-enoic acid
SMILESC1CCCC1.CCCC/C=C/C(=O)O
InChIInChI=1S/C7H12O2.C5H10/c1-2-3-4-5-6-7(8)9;1-2-4-5-3-1/h5-6H,2-4H2,1H3,(H,8,9);1-5H2/b6-5+;
InChIKeyHYHRQSRVNNJKDC-IPZCTEOASA-N
XLogP3.77
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.31
LogP ≤ 53.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze cyclopentane;(E)-hept-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclopentane;(E)-hept-2-enoic acid?
The IUPAC name of cyclopentane;(E)-hept-2-enoic acid (CID 66887361) is cyclopentane;(E)-hept-2-enoic acid.
What is the SMILES notation for cyclopentane;(E)-hept-2-enoic acid?
The canonical SMILES for cyclopentane;(E)-hept-2-enoic acid is C1CCCC1.CCCC/C=C/C(=O)O.
What is the InChIKey of cyclopentane;(E)-hept-2-enoic acid?
The InChIKey is HYHRQSRVNNJKDC-IPZCTEOASA-N. The full InChI is InChI=1S/C7H12O2.C5H10/c1-2-3-4-5-6-7(8)9;1-2-4-5-3-1/h5-6H,2-4H2,1H3,(H,8,9);1-5H2/b6-5+;.
What are the key properties of cyclopentane;(E)-hept-2-enoic acid?
cyclopentane;(E)-hept-2-enoic acid has a molecular weight of 198.31 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;(E)-hept-2-enoic acid is sourced from PubChem (CID 66887361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).