C9H11F3O — CID 51357228
(2E,5E)-1,1,1-trifluoronona-2,5-dien-4-one (PubChem CID 51357228) has the molecular formula C9H11F3O and a molecular weight of 192.18 g/mol. Its IUPAC name is (2E,5E)-1,1,1-trifluoronona-2,5-dien-4-one.
| Compound Name | (2E,5E)-1,1,1-trifluoronona-2,5-dien-4-one |
|---|---|
| PubChem CID | 51357228 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (2E,5E)-1,1,1-trifluoronona-2,5-dien-4-one |
| SMILES | CCC/C=C/C(=O)/C=C/C(F)(F)F |
| InChI | InChI=1S/C9H11F3O/c1-2-3-4-5-8(13)6-7-9(10,11)12/h4-7H,2-3H2,1H3/b5-4+,7-6+ |
| InChIKey | QTSAUGBLXBYUEC-YTXTXJHMSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|