C19H29F3O3 — CID 153327415
[(3E,6E)-5-oxoheptadeca-3,6-dienyl] 2,2,2-trifluoroacetate (PubChem CID 153327415) has the molecular formula C19H29F3O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is [(3E,6E)-5-oxoheptadeca-3,6-dienyl] 2,2,2-trifluoroacetate.
| Compound Name | [(3E,6E)-5-oxoheptadeca-3,6-dienyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 153327415 |
| Molecular Formula | C19H29F3O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(3E,6E)-5-oxoheptadeca-3,6-dienyl] 2,2,2-trifluoroacetate |
| SMILES | CCCCCCCCCC/C=C/C(=O)/C=C/CCOC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H29F3O3/c1-2-3-4-5-6-7-8-9-10-11-14-17(23)15-12-13-16-25-18(24)19(20,21)22/h11-12,14-15H,2-10,13,16H2,1H3/b14-11+,15-12+ |
| InChIKey | FOPHVKWVLHCJAY-LCPPQYOVSA-N |
| XLogP | 5.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|