About (E)-hex-2-enamide;hydrochloride
(E)-hex-2-enamide;hydrochloride (PubChem CID 141291310) has the molecular formula C6H12ClNO
and a molecular weight of 149.62 g/mol. Its IUPAC name is (E)-hex-2-enamide;hydrochloride.
Molecular Properties
| Compound Name | (E)-hex-2-enamide;hydrochloride |
| PubChem CID | 141291310 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | (E)-hex-2-enamide;hydrochloride |
| SMILES | CCC/C=C/C(N)=O.Cl |
| InChI | InChI=1S/C6H11NO.ClH/c1-2-3-4-5-6(7)8;/h4-5H,2-3H2,1H3,(H2,7,8);1H/b5-4+; |
| InChIKey | QRHCCGCQENJGFN-FXRZFVDSSA-N |
| XLogP | 1.25 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-hex-2-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hex-2-enamide;hydrochloride?
The IUPAC name of (E)-hex-2-enamide;hydrochloride (CID 141291310) is (E)-hex-2-enamide;hydrochloride.
What is the SMILES notation for (E)-hex-2-enamide;hydrochloride?
The canonical SMILES for (E)-hex-2-enamide;hydrochloride is CCC/C=C/C(N)=O.Cl.
What is the InChIKey of (E)-hex-2-enamide;hydrochloride?
The InChIKey is QRHCCGCQENJGFN-FXRZFVDSSA-N. The full InChI is InChI=1S/C6H11NO.ClH/c1-2-3-4-5-6(7)8;/h4-5H,2-3H2,1H3,(H2,7,8);1H/b5-4+;.
What are the key properties of (E)-hex-2-enamide;hydrochloride?
(E)-hex-2-enamide;hydrochloride has a molecular weight of 149.62 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hex-2-enamide;hydrochloride is sourced from PubChem (CID 141291310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).