C20H29NO — CID 91451907
icosa-2,5,8,11,14,17-hexaenamide (PubChem CID 91451907) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is icosa-2,5,8,11,14,17-hexaenamide.
| Compound Name | icosa-2,5,8,11,14,17-hexaenamide |
|---|---|
| PubChem CID | 91451907 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | icosa-2,5,8,11,14,17-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CC(N)=O |
| InChI | InChI=1S/C20H29NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17H2,1H3,(H2,21,22) |
| InChIKey | MMOPVGIKPQTCAN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|