C10H10F6O2 — CID 162111874
(E)-5,5,5-trifluoropent-3-en-2-one (PubChem CID 162111874) has the molecular formula C10H10F6O2 and a molecular weight of 276.18 g/mol. Its IUPAC name is (E)-5,5,5-trifluoropent-3-en-2-one.
| Compound Name | (E)-5,5,5-trifluoropent-3-en-2-one |
|---|---|
| PubChem CID | 162111874 |
| Molecular Formula | C10H10F6O2 |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (E)-5,5,5-trifluoropent-3-en-2-one |
| SMILES | CC(=O)/C=C/C(F)(F)F.CC(=O)/C=C/C(F)(F)F |
| InChI | InChI=1S/2C5H5F3O/c2*1-4(9)2-3-5(6,7)8/h2*2-3H,1H3/b2*3-2+ |
| InChIKey | ZGGJREQUGVGSSD-XQHVRGAUSA-N |
| XLogP | 3.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|