C12H18O — CID 5363803
(3E)-5,5,8-trimethylnona-3,6,7-trien-2-one (PubChem CID 5363803) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (3E)-5,5,8-trimethylnona-3,6,7-trien-2-one.
| Compound Name | (3E)-5,5,8-trimethylnona-3,6,7-trien-2-one |
|---|---|
| PubChem CID | 5363803 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (3E)-5,5,8-trimethylnona-3,6,7-trien-2-one |
| SMILES | CC(=O)/C=C/C(C)(C)C=C=C(C)C |
| InChI | InChI=1S/C12H18O/c1-10(2)6-8-12(4,5)9-7-11(3)13/h7-9H,1-5H3/b9-7+ |
| InChIKey | IALPRXVIEZJWFW-VQHVLOKHSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|