C11H17NO2 — CID 177383942
[(E)-2,2,5-trimethylhexa-3,4-dienylideneamino] acetate (PubChem CID 177383942) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is [(E)-2,2,5-trimethylhexa-3,4-dienylideneamino] acetate.
| Compound Name | [(E)-2,2,5-trimethylhexa-3,4-dienylideneamino] acetate |
|---|---|
| PubChem CID | 177383942 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | [(E)-2,2,5-trimethylhexa-3,4-dienylideneamino] acetate |
| SMILES | CC(=O)O/N=C/C(C)(C)C=C=C(C)C |
| InChI | InChI=1S/C11H17NO2/c1-9(2)6-7-11(4,5)8-12-14-10(3)13/h7-8H,1-5H3/b12-8+ |
| InChIKey | KJUXBJZZQYATHL-XYOKQWHBSA-N |
| XLogP | 2.68 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|