C25H23NO2 — CID 15636099
[(E)-(2,2-dimethyl-4,4-diphenylbut-3-enylidene)amino] benzoate (PubChem CID 15636099) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is [(E)-(2,2-dimethyl-4,4-diphenylbut-3-enylidene)amino] benzoate.
| Compound Name | [(E)-(2,2-dimethyl-4,4-diphenylbut-3-enylidene)amino] benzoate |
|---|---|
| PubChem CID | 15636099 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [(E)-(2,2-dimethyl-4,4-diphenylbut-3-enylidene)amino] benzoate |
| SMILES | CC(C)(C=C(c1ccccc1)c1ccccc1)/C=N/OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H23NO2/c1-25(2,19-26-28-24(27)22-16-10-5-11-17-22)18-23(20-12-6-3-7-13-20)21-14-8-4-9-15-21/h3-19H,1-2H3/b26-19+ |
| InChIKey | YPMDFAKMIJDKFY-LGUFXXKBSA-N |
| XLogP | 5.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|