C20H21NO — CID 10979181
(E)-2-ethenyl-N-methoxy-2-methyl-4,4-diphenylbut-3-en-1-imine (PubChem CID 10979181) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (E)-2-ethenyl-N-methoxy-2-methyl-4,4-diphenylbut-3-en-1-imine.
| Compound Name | (E)-2-ethenyl-N-methoxy-2-methyl-4,4-diphenylbut-3-en-1-imine |
|---|---|
| PubChem CID | 10979181 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (E)-2-ethenyl-N-methoxy-2-methyl-4,4-diphenylbut-3-en-1-imine |
| SMILES | C=CC(C)(C=C(c1ccccc1)c1ccccc1)/C=N/OC |
| InChI | InChI=1S/C20H21NO/c1-4-20(2,16-21-22-3)15-19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h4-16H,1H2,2-3H3/b21-16+ |
| InChIKey | QUPBYHBCDCRLIC-LTGZKZEYSA-N |
| XLogP | 4.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|