C18H21BIP — CID 21027985
[(2,2-dimethyl-4,4-diphenylbut-3-enyl)-iodoboranyl]phosphane (PubChem CID 21027985) has the molecular formula C18H21BIP and a molecular weight of 406.06 g/mol. Its IUPAC name is [(2,2-dimethyl-4,4-diphenylbut-3-enyl)-iodoboranyl]phosphane.
| Compound Name | [(2,2-dimethyl-4,4-diphenylbut-3-enyl)-iodoboranyl]phosphane |
|---|---|
| PubChem CID | 21027985 |
| Molecular Formula | C18H21BIP |
| Molecular Weight | 406.06 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | [(2,2-dimethyl-4,4-diphenylbut-3-enyl)-iodoboranyl]phosphane |
| SMILES | CC(C)(C=C(c1ccccc1)c1ccccc1)CB(P)I |
| InChI | InChI=1S/C18H21BIP/c1-18(2,14-19(20)21)13-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-13H,14,21H2,1-2H3 |
| InChIKey | JTPIHAIORYQBJN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.06 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|