C17H13BrF4 — CID 132943042
1-[(Z)-4-bromo-3,3,4,4-tetrafluoro-1-phenylbut-1-enyl]-4-methylbenzene (PubChem CID 132943042) has the molecular formula C17H13BrF4 and a molecular weight of 373.19 g/mol. Its IUPAC name is 1-[(Z)-4-bromo-3,3,4,4-tetrafluoro-1-phenylbut-1-enyl]-4-methylbenzene.
| Compound Name | 1-[(Z)-4-bromo-3,3,4,4-tetrafluoro-1-phenylbut-1-enyl]-4-methylbenzene |
|---|---|
| PubChem CID | 132943042 |
| Molecular Formula | C17H13BrF4 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 1-[(Z)-4-bromo-3,3,4,4-tetrafluoro-1-phenylbut-1-enyl]-4-methylbenzene |
| SMILES | Cc1ccc(/C(=C\C(F)(F)C(F)(F)Br)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H13BrF4/c1-12-7-9-14(10-8-12)15(13-5-3-2-4-6-13)11-16(19,20)17(18,21)22/h2-11H,1H3/b15-11- |
| InChIKey | PZCYBDRXEOWMGJ-PTNGSMBKSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|