C20H11ClF12 — CID 100930798
(8-chloro-3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1-phenyloct-1-enyl)benzene (PubChem CID 100930798) has the molecular formula C20H11ClF12 and a molecular weight of 514.74 g/mol. Its IUPAC name is (8-chloro-3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1-phenyloct-1-enyl)benzene.
| Compound Name | (8-chloro-3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1-phenyloct-1-enyl)benzene |
|---|---|
| PubChem CID | 100930798 |
| Molecular Formula | C20H11ClF12 |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | (8-chloro-3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1-phenyloct-1-enyl)benzene |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H11ClF12/c21-20(32,33)19(30,31)18(28,29)17(26,27)16(24,25)15(22,23)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H |
| InChIKey | VRBVDWFYKDEZMT-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|