C17H9F9OS — CID 139095333
(E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-phenyl-1-thiophen-3-ylhept-2-en-1-one (PubChem CID 139095333) has the molecular formula C17H9F9OS and a molecular weight of 432.31 g/mol. Its IUPAC name is (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-phenyl-1-thiophen-3-ylhept-2-en-1-one.
| Compound Name | (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-phenyl-1-thiophen-3-ylhept-2-en-1-one |
|---|---|
| PubChem CID | 139095333 |
| Molecular Formula | C17H9F9OS |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | (E)-4,4,5,5,6,6,7,7,7-nonafluoro-2-phenyl-1-thiophen-3-ylhept-2-en-1-one |
| SMILES | O=C(/C(=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1)c1ccsc1 |
| InChI | InChI=1S/C17H9F9OS/c18-14(19,15(20,21)16(22,23)17(24,25)26)8-12(10-4-2-1-3-5-10)13(27)11-6-7-28-9-11/h1-9H/b12-8+ |
| InChIKey | QGGFKTCZMLBBKJ-XYOKQWHBSA-N |
| XLogP | 6.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|