C13H5F11O — CID 12014649
(E)-2,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-phenylhept-2-en-1-one (PubChem CID 12014649) has the molecular formula C13H5F11O and a molecular weight of 386.16 g/mol. Its IUPAC name is (E)-2,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-phenylhept-2-en-1-one.
| Compound Name | (E)-2,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-phenylhept-2-en-1-one |
|---|---|
| PubChem CID | 12014649 |
| Molecular Formula | C13H5F11O |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (E)-2,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-phenylhept-2-en-1-one |
| SMILES | O=C(/C(F)=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H5F11O/c14-7(8(25)6-4-2-1-3-5-6)9(15)10(16,17)11(18,19)12(20,21)13(22,23)24/h1-5H/b9-7+ |
| InChIKey | YITPAYNABKILJO-VQHVLOKHSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|