C7BrF11O — CID 87352429
2,3,4,4,5,5,6,6,7,7,7-undecafluorohept-2-enoyl bromide (PubChem CID 87352429) has the molecular formula C7BrF11O and a molecular weight of 388.96 g/mol. Its IUPAC name is 2,3,4,4,5,5,6,6,7,7,7-undecafluorohept-2-enoyl bromide.
| Compound Name | 2,3,4,4,5,5,6,6,7,7,7-undecafluorohept-2-enoyl bromide |
|---|---|
| PubChem CID | 87352429 |
| Molecular Formula | C7BrF11O |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 387.90 |
| IUPAC Name | 2,3,4,4,5,5,6,6,7,7,7-undecafluorohept-2-enoyl bromide |
| SMILES | O=C(Br)C(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7BrF11O/c8-3(20)1(9)2(10)4(11,12)5(13,14)6(15,16)7(17,18)19 |
| InChIKey | OHOXGZHNYUERHK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|