C12H7F17O — CID 160651878
methane;1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluorohept-1-ene;3,4,4-trifluorobut-3-en-2-one (PubChem CID 160651878) has the molecular formula C12H7F17O and a molecular weight of 490.15 g/mol. Its IUPAC name is methane;1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluorohept-1-ene;3,4,4-trifluorobut-3-en-2-one.
| Compound Name | methane;1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluorohept-1-ene;3,4,4-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 160651878 |
| Molecular Formula | C12H7F17O |
| Molecular Weight | 490.15 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | methane;1,1,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluorohept-1-ene;3,4,4-trifluorobut-3-en-2-one |
| SMILES | C.CC(=O)C(F)=C(F)F.FC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7F14.C4H3F3O.CH4/c8-1(2(9)10)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)21;1-2(8)3(5)4(6)7;/h;1H3;1H4 |
| InChIKey | RKNMGXMTYUHEGS-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.15 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|