C12H2F16O4 — CID 173141414
2,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11-hexadecafluorododeca-2,10-dienedioic acid (PubChem CID 173141414) has the molecular formula C12H2F16O4 and a molecular weight of 514.11 g/mol. Its IUPAC name is 2,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11-hexadecafluorododeca-2,10-dienedioic acid.
| Compound Name | 2,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11-hexadecafluorododeca-2,10-dienedioic acid |
|---|---|
| PubChem CID | 173141414 |
| Molecular Formula | C12H2F16O4 |
| Molecular Weight | 514.11 g/mol |
| Exact Mass | 513.97 |
| IUPAC Name | 2,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11-hexadecafluorododeca-2,10-dienedioic acid |
| SMILES | O=C(O)C(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)=C(F)C(=O)O |
| InChI | InChI=1S/C12H2F16O4/c13-1(5(29)30)3(15)7(17,18)9(21,22)11(25,26)12(27,28)10(23,24)8(19,20)4(16)2(14)6(31)32/h(H,29,30)(H,31,32) |
| InChIKey | IIBLJONGGUGISL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.11 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|