C6F10O — CID 91153512
1,1,1,3,4,5,5,6,6,6-decafluorohex-3-en-2-one (PubChem CID 91153512) has the molecular formula C6F10O and a molecular weight of 278.05 g/mol. Its IUPAC name is 1,1,1,3,4,5,5,6,6,6-decafluorohex-3-en-2-one.
| Compound Name | 1,1,1,3,4,5,5,6,6,6-decafluorohex-3-en-2-one |
|---|---|
| PubChem CID | 91153512 |
| Molecular Formula | C6F10O |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 1,1,1,3,4,5,5,6,6,6-decafluorohex-3-en-2-one |
| SMILES | O=C(C(F)=C(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F10O/c7-1(3(17)5(11,12)13)2(8)4(9,10)6(14,15)16 |
| InChIKey | NNLOEQYKNGKQBN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|