C6F10O2 — CID 12567521
1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pentane-2,3-dione (PubChem CID 12567521) has the molecular formula C6F10O2 and a molecular weight of 294.04 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pentane-2,3-dione.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pentane-2,3-dione |
|---|---|
| PubChem CID | 12567521 |
| Molecular Formula | C6F10O2 |
| Molecular Weight | 294.04 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pentane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F10O2/c7-3(5(11,12)13,6(14,15)16)1(17)2(18)4(8,9)10 |
| InChIKey | BOPGPASYCOFVSI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.04 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|