C6H2F8O2 — CID 54418635
1,1,1,4,4,5,5,6-octafluorohexane-2,3-dione (PubChem CID 54418635) has the molecular formula C6H2F8O2 and a molecular weight of 258.06 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,6-octafluorohexane-2,3-dione.
| Compound Name | 1,1,1,4,4,5,5,6-octafluorohexane-2,3-dione |
|---|---|
| PubChem CID | 54418635 |
| Molecular Formula | C6H2F8O2 |
| Molecular Weight | 258.06 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1,1,1,4,4,5,5,6-octafluorohexane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)C(F)(F)CF)C(F)(F)F |
| InChI | InChI=1S/C6H2F8O2/c7-1-4(8,9)5(10,11)2(15)3(16)6(12,13)14/h1H2 |
| InChIKey | VZFCICRMGCBVNH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.06 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|