C14H12CuF12O4 — CID 175437168
copper;bis(1,1,1,4,4,5-hexafluoroheptane-2,3-dione) (PubChem CID 175437168) has the molecular formula C14H12CuF12O4 and a molecular weight of 535.77 g/mol. Its IUPAC name is copper;bis(1,1,1,4,4,5-hexafluoroheptane-2,3-dione).
| Compound Name | copper;bis(1,1,1,4,4,5-hexafluoroheptane-2,3-dione) |
|---|---|
| PubChem CID | 175437168 |
| Molecular Formula | C14H12CuF12O4 |
| Molecular Weight | 535.77 g/mol |
| Exact Mass | 534.98 |
| IUPAC Name | copper;bis(1,1,1,4,4,5-hexafluoroheptane-2,3-dione) |
| SMILES | CCC(F)C(F)(F)C(=O)C(=O)C(F)(F)F.CCC(F)C(F)(F)C(=O)C(=O)C(F)(F)F.[Cu] |
| InChI | InChI=1S/2C7H6F6O2.Cu/c2*1-2-3(8)6(9,10)4(14)5(15)7(11,12)13;/h2*3H,2H2,1H3; |
| InChIKey | LWCLFYZAFLBIQO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|