C7H6F8O3 — CID 19880908
1,1,2,2,3-pentafluoropentyl 2,2,2-trifluoroethaneperoxoate (PubChem CID 19880908) has the molecular formula C7H6F8O3 and a molecular weight of 290.11 g/mol. Its IUPAC name is 1,1,2,2,3-pentafluoropentyl 2,2,2-trifluoroethaneperoxoate.
| Compound Name | 1,1,2,2,3-pentafluoropentyl 2,2,2-trifluoroethaneperoxoate |
|---|---|
| PubChem CID | 19880908 |
| Molecular Formula | C7H6F8O3 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 1,1,2,2,3-pentafluoropentyl 2,2,2-trifluoroethaneperoxoate |
| SMILES | CCC(F)C(F)(F)C(F)(F)OOC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H6F8O3/c1-2-3(8)5(9,10)7(14,15)18-17-4(16)6(11,12)13/h3H,2H2,1H3 |
| InChIKey | ACBRDCQGSLFUHK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|