About 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate
2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate (PubChem CID 14535336) has the molecular formula C8H8F6O4
and a molecular weight of 282.14 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate.
Analyze 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate?
The IUPAC name of 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate (CID 14535336) is 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate.
What is the SMILES notation for 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate?
The canonical SMILES for 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate is CCC(COC(=O)C(F)(F)F)OC(=O)C(F)(F)F.
What is the InChIKey of 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate?
The InChIKey is COZSCUJGAIXOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F6O4/c1-2-4(18-6(16)8(12,13)14)3-17-5(15)7(9,10)11/h4H,2-3H2,1H3.
What are the key properties of 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate?
2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate has a molecular weight of 282.14 g/mol, XLogP of 1.98, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroacetyl)oxybutyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 14535336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).