C14H16F6O6 — CID 139957460
cyclohexyl 3,4-bis[(2,2,2-trifluoroacetyl)oxy]butanoate (PubChem CID 139957460) has the molecular formula C14H16F6O6 and a molecular weight of 394.26 g/mol. Its IUPAC name is cyclohexyl 3,4-bis[(2,2,2-trifluoroacetyl)oxy]butanoate.
| Compound Name | cyclohexyl 3,4-bis[(2,2,2-trifluoroacetyl)oxy]butanoate |
|---|---|
| PubChem CID | 139957460 |
| Molecular Formula | C14H16F6O6 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | cyclohexyl 3,4-bis[(2,2,2-trifluoroacetyl)oxy]butanoate |
| SMILES | O=C(CC(COC(=O)C(F)(F)F)OC(=O)C(F)(F)F)OC1CCCCC1 |
| InChI | InChI=1S/C14H16F6O6/c15-13(16,17)11(22)24-7-9(26-12(23)14(18,19)20)6-10(21)25-8-4-2-1-3-5-8/h8-9H,1-7H2 |
| InChIKey | DEZRWXXBPMYBEJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|