About dicyclohexyl 2-aminobutanedioate chloride
dicyclohexyl 2-aminobutanedioate chloride (PubChem CID 53312802) has the molecular formula C16H27ClNO4-
and a molecular weight of 332.85 g/mol. Its IUPAC name is dicyclohexyl 2-aminobutanedioate chloride.
Molecular Properties
| Compound Name | dicyclohexyl 2-aminobutanedioate chloride |
| PubChem CID | 53312802 |
| Molecular Formula | C16H27ClNO4- |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | dicyclohexyl 2-aminobutanedioate chloride |
| SMILES | NC(CC(=O)OC1CCCCC1)C(=O)OC1CCCCC1.[Cl-] |
| InChI | InChI=1S/C16H27NO4.ClH/c17-14(16(19)21-13-9-5-2-6-10-13)11-15(18)20-12-7-3-1-4-8-12;/h12-14H,1-11,17H2;1H/p-1 |
| InChIKey | PBKHPBAIBQLFSM-UHFFFAOYSA-M |
| XLogP | -0.54 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dicyclohexyl 2-aminobutanedioate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl 2-aminobutanedioate chloride?
The IUPAC name of dicyclohexyl 2-aminobutanedioate chloride (CID 53312802) is dicyclohexyl 2-aminobutanedioate chloride.
What is the SMILES notation for dicyclohexyl 2-aminobutanedioate chloride?
The canonical SMILES for dicyclohexyl 2-aminobutanedioate chloride is NC(CC(=O)OC1CCCCC1)C(=O)OC1CCCCC1.[Cl-].
What is the InChIKey of dicyclohexyl 2-aminobutanedioate chloride?
The InChIKey is PBKHPBAIBQLFSM-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H27NO4.ClH/c17-14(16(19)21-13-9-5-2-6-10-13)11-15(18)20-12-7-3-1-4-8-12;/h12-14H,1-11,17H2;1H/p-1.
What are the key properties of dicyclohexyl 2-aminobutanedioate chloride?
dicyclohexyl 2-aminobutanedioate chloride has a molecular weight of 332.85 g/mol, XLogP of -0.54, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl 2-aminobutanedioate chloride is sourced from PubChem (CID 53312802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).