About cyclopentyl 2-aminobutanoate;molecular hydrogen
cyclopentyl 2-aminobutanoate;molecular hydrogen (PubChem CID 143574438) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is cyclopentyl 2-aminobutanoate;molecular hydrogen.
Molecular Properties
| Compound Name | cyclopentyl 2-aminobutanoate;molecular hydrogen |
| PubChem CID | 143574438 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | cyclopentyl 2-aminobutanoate;molecular hydrogen |
| SMILES | CCC(N)C(=O)OC1CCCC1.[H][H] |
| InChI | InChI=1S/C9H17NO2.H2/c1-2-8(10)9(11)12-7-5-3-4-6-7;/h7-8H,2-6,10H2,1H3;1H |
| InChIKey | KWNHLLXTRYIICM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentyl 2-aminobutanoate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 2-aminobutanoate;molecular hydrogen?
The IUPAC name of cyclopentyl 2-aminobutanoate;molecular hydrogen (CID 143574438) is cyclopentyl 2-aminobutanoate;molecular hydrogen.
What is the SMILES notation for cyclopentyl 2-aminobutanoate;molecular hydrogen?
The canonical SMILES for cyclopentyl 2-aminobutanoate;molecular hydrogen is CCC(N)C(=O)OC1CCCC1.[H][H].
What is the InChIKey of cyclopentyl 2-aminobutanoate;molecular hydrogen?
The InChIKey is KWNHLLXTRYIICM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.H2/c1-2-8(10)9(11)12-7-5-3-4-6-7;/h7-8H,2-6,10H2,1H3;1H.
What are the key properties of cyclopentyl 2-aminobutanoate;molecular hydrogen?
cyclopentyl 2-aminobutanoate;molecular hydrogen has a molecular weight of 173.26 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 2-aminobutanoate;molecular hydrogen is sourced from PubChem (CID 143574438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).