C8H8Br6O4 — CID 139879427
2-(2,2,2-tribromoacetyl)oxybutyl 2,2,2-tribromoacetate (PubChem CID 139879427) has the molecular formula C8H8Br6O4 and a molecular weight of 647.57 g/mol. Its IUPAC name is 2-(2,2,2-tribromoacetyl)oxybutyl 2,2,2-tribromoacetate.
| Compound Name | 2-(2,2,2-tribromoacetyl)oxybutyl 2,2,2-tribromoacetate |
|---|---|
| PubChem CID | 139879427 |
| Molecular Formula | C8H8Br6O4 |
| Molecular Weight | 647.57 g/mol |
| Exact Mass | 641.55 |
| IUPAC Name | 2-(2,2,2-tribromoacetyl)oxybutyl 2,2,2-tribromoacetate |
| SMILES | CCC(COC(=O)C(Br)(Br)Br)OC(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C8H8Br6O4/c1-2-4(18-6(16)8(12,13)14)3-17-5(15)7(9,10)11/h4H,2-3H2,1H3 |
| InChIKey | FLTNLDXAMLNAGG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|