C15H26O6 — CID 58900391
1,3-di(propanoyloxy)propan-2-yl 2,2-dimethylbutanoate (PubChem CID 58900391) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1,3-di(propanoyloxy)propan-2-yl 2,2-dimethylbutanoate.
| Compound Name | 1,3-di(propanoyloxy)propan-2-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58900391 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1,3-di(propanoyloxy)propan-2-yl 2,2-dimethylbutanoate |
| SMILES | CCC(=O)OCC(COC(=O)CC)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C15H26O6/c1-6-12(16)19-9-11(10-20-13(17)7-2)21-14(18)15(4,5)8-3/h11H,6-10H2,1-5H3 |
| InChIKey | YKBYIQSDDVJTJS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|