C11H22N2O12P2 — CID 58695527
[[1-(2,2-dimethylbutanoyloxy)-3-(phosphonocarbamoyloxy)propan-2-yl]oxycarbonylamino]phosphonic acid (PubChem CID 58695527) has the molecular formula C11H22N2O12P2 and a molecular weight of 436.25 g/mol. Its IUPAC name is [[1-(2,2-dimethylbutanoyloxy)-3-(phosphonocarbamoyloxy)propan-2-yl]oxycarbonylamino]phosphonic acid.
| Compound Name | [[1-(2,2-dimethylbutanoyloxy)-3-(phosphonocarbamoyloxy)propan-2-yl]oxycarbonylamino]phosphonic acid |
|---|---|
| PubChem CID | 58695527 |
| Molecular Formula | C11H22N2O12P2 |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [[1-(2,2-dimethylbutanoyloxy)-3-(phosphonocarbamoyloxy)propan-2-yl]oxycarbonylamino]phosphonic acid |
| SMILES | CCC(C)(C)C(=O)OCC(COC(=O)NP(=O)(O)O)OC(=O)NP(=O)(O)O |
| InChI | InChI=1S/C11H22N2O12P2/c1-4-11(2,3)8(14)23-5-7(25-10(16)13-27(20,21)22)6-24-9(15)12-26(17,18)19/h7H,4-6H2,1-3H3,(H3,12,15,17,18,19)(H3,13,16,20,21,22) |
| InChIKey | OKHGRXMWJQNLPZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 218.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|