C38H70O9 — CID 174294700
[1-butanoyloxy-3-[3-butanoyloxy-2-(2,2,5,5,6-pentamethylheptanoyloxy)propoxy]propan-2-yl] 2,2,5,5,6-pentamethylheptanoate (PubChem CID 174294700) has the molecular formula C38H70O9 and a molecular weight of 670.97 g/mol. Its IUPAC name is [1-butanoyloxy-3-[3-butanoyloxy-2-(2,2,5,5,6-pentamethylheptanoyloxy)propoxy]propan-2-yl] 2,2,5,5,6-pentamethylheptanoate.
| Compound Name | [1-butanoyloxy-3-[3-butanoyloxy-2-(2,2,5,5,6-pentamethylheptanoyloxy)propoxy]propan-2-yl] 2,2,5,5,6-pentamethylheptanoate |
|---|---|
| PubChem CID | 174294700 |
| Molecular Formula | C38H70O9 |
| Molecular Weight | 670.97 g/mol |
| Exact Mass | 670.50 |
| IUPAC Name | [1-butanoyloxy-3-[3-butanoyloxy-2-(2,2,5,5,6-pentamethylheptanoyloxy)propoxy]propan-2-yl] 2,2,5,5,6-pentamethylheptanoate |
| SMILES | CCCC(=O)OCC(COCC(COC(=O)CCC)OC(=O)C(C)(C)CCC(C)(C)C(C)C)OC(=O)C(C)(C)CCC(C)(C)C(C)C |
| InChI | InChI=1S/C38H70O9/c1-15-17-31(39)44-25-29(46-33(41)37(11,12)21-19-35(7,8)27(3)4)23-43-24-30(26-45-32(40)18-16-2)47-34(42)38(13,14)22-20-36(9,10)28(5)6/h27-30H,15-26H2,1-14H3 |
| InChIKey | CJGVKRQSWISYCH-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.97 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|