C44H83NO9 — CID 174294353
[1-butanoyloxy-3-[3-[ethyl(2,2,3-trimethylbutyl)carbamoyl]oxy-2-(2,2,5,5,6-pentamethylheptanoyloxy)propoxy]propan-2-yl] 2,2,5,5,6-pentamethylheptanoate (PubChem CID 174294353) has the molecular formula C44H83NO9 and a molecular weight of 770.15 g/mol. Its IUPAC name is [1-butanoyloxy-3-[3-[ethyl(2,2,3-trimethylbutyl)carbamoyl]oxy-2-(2,2,5,5,6-pentamethylheptanoyloxy)propoxy]propan-2-yl] 2,2,5,5,6-pentamethylheptanoate.
| Compound Name | [1-butanoyloxy-3-[3-[ethyl(2,2,3-trimethylbutyl)carbamoyl]oxy-2-(2,2,5,5,6-pentamethylheptanoyloxy)propoxy]propan-2-yl] 2,2,5,5,6-pentamethylheptanoate |
|---|---|
| PubChem CID | 174294353 |
| Molecular Formula | C44H83NO9 |
| Molecular Weight | 770.15 g/mol |
| Exact Mass | 769.61 |
| IUPAC Name | [1-butanoyloxy-3-[3-[ethyl(2,2,3-trimethylbutyl)carbamoyl]oxy-2-(2,2,5,5,6-pentamethylheptanoyloxy)propoxy]propan-2-yl] 2,2,5,5,6-pentamethylheptanoate |
| SMILES | CCCC(=O)OCC(COCC(COC(=O)N(CC)CC(C)(C)C(C)C)OC(=O)C(C)(C)CCC(C)(C)C(C)C)OC(=O)C(C)(C)CCC(C)(C)C(C)C |
| InChI | InChI=1S/C44H83NO9/c1-19-21-36(46)51-28-34(53-37(47)42(13,14)24-22-40(9,10)31(3)4)26-50-27-35(29-52-39(49)45(20-2)30-44(17,18)33(7)8)54-38(48)43(15,16)25-23-41(11,12)32(5)6/h31-35H,19-30H2,1-18H3 |
| InChIKey | UBPCFMJMNXYIFA-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.15 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|