C30H28N2O4 — CID 118272270
2-(diphenylcarbamoyloxy)butyl N,N-diphenylcarbamate (PubChem CID 118272270) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is 2-(diphenylcarbamoyloxy)butyl N,N-diphenylcarbamate.
| Compound Name | 2-(diphenylcarbamoyloxy)butyl N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 118272270 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-(diphenylcarbamoyloxy)butyl N,N-diphenylcarbamate |
| SMILES | CCC(COC(=O)N(c1ccccc1)c1ccccc1)OC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O4/c1-2-28(36-30(34)32(26-19-11-5-12-20-26)27-21-13-6-14-22-27)23-35-29(33)31(24-15-7-3-8-16-24)25-17-9-4-10-18-25/h3-22,28H,2,23H2,1H3 |
| InChIKey | RVLYSWXBGTXGAL-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |