C33H29NO4 — CID 88847626
ethyl N,N-diphenylcarbamate;octadeca-2,4,8,10,14,16-hexayne-1,18-diol (PubChem CID 88847626) has the molecular formula C33H29NO4 and a molecular weight of 503.60 g/mol. Its IUPAC name is ethyl N,N-diphenylcarbamate;octadeca-2,4,8,10,14,16-hexayne-1,18-diol.
| Compound Name | ethyl N,N-diphenylcarbamate;octadeca-2,4,8,10,14,16-hexayne-1,18-diol |
|---|---|
| PubChem CID | 88847626 |
| Molecular Formula | C33H29NO4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | ethyl N,N-diphenylcarbamate;octadeca-2,4,8,10,14,16-hexayne-1,18-diol |
| SMILES | CCOC(=O)N(c1ccccc1)c1ccccc1.OCC#CC#CCCC#CC#CCCC#CC#CCO |
| InChI | InChI=1S/C18H14O2.C15H15NO2/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20;1-2-18-15(17)16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h19-20H,5-8,17-18H2;3-12H,2H2,1H3 |
| InChIKey | PMLFDOWWOIWAKK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|