C16H13NO2 — CID 57250810
4-hydroxy-N,N-diphenylbut-2-ynamide (PubChem CID 57250810) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-hydroxy-N,N-diphenylbut-2-ynamide.
| Compound Name | 4-hydroxy-N,N-diphenylbut-2-ynamide |
|---|---|
| PubChem CID | 57250810 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 4-hydroxy-N,N-diphenylbut-2-ynamide |
| SMILES | O=C(C#CCO)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H13NO2/c18-13-7-12-16(19)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,18H,13H2 |
| InChIKey | ADFBUUIYNLCQOQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|