About 4-hydroxy-N,N-diphenylbut-2-ynamide
4-hydroxy-N,N-diphenylbut-2-ynamide (PubChem CID 57250810) has the molecular formula C16H13NO2
and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-hydroxy-N,N-diphenylbut-2-ynamide.
Molecular Properties
| Compound Name | 4-hydroxy-N,N-diphenylbut-2-ynamide |
| PubChem CID | 57250810 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 4-hydroxy-N,N-diphenylbut-2-ynamide |
| SMILES | O=C(C#CCO)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H13NO2/c18-13-7-12-16(19)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,18H,13H2 |
| InChIKey | ADFBUUIYNLCQOQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-N,N-diphenylbut-2-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N,N-diphenylbut-2-ynamide?
The IUPAC name of 4-hydroxy-N,N-diphenylbut-2-ynamide (CID 57250810) is 4-hydroxy-N,N-diphenylbut-2-ynamide.
What is the SMILES notation for 4-hydroxy-N,N-diphenylbut-2-ynamide?
The canonical SMILES for 4-hydroxy-N,N-diphenylbut-2-ynamide is O=C(C#CCO)N(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-hydroxy-N,N-diphenylbut-2-ynamide?
The InChIKey is ADFBUUIYNLCQOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c18-13-7-12-16(19)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,18H,13H2.
What are the key properties of 4-hydroxy-N,N-diphenylbut-2-ynamide?
4-hydroxy-N,N-diphenylbut-2-ynamide has a molecular weight of 251.28 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N,N-diphenylbut-2-ynamide is sourced from PubChem (CID 57250810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).