cobalt;bis(diphenylcarbamic acid)

C26H22CoN2O4 — CID 155679078

IUPACcobalt;bis(diphenylcarbamic acid)
SMILESO=C(O)N(c1ccccc1)c1ccccc1.O=C(O)N(c1ccccc1)c1ccccc1.[Co]
InChIInChI=1S/2C13H11NO2.Co/c2*15-13(16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h2*1-10H,(H,15,16);
InChIKeyRYRTYJTVYGOIGH-UHFFFAOYSA-N
MW485.41 g/mol
LogP7.00
Rot. Bonds4

About cobalt;bis(diphenylcarbamic acid)

cobalt;bis(diphenylcarbamic acid) (PubChem CID 155679078) has the molecular formula C26H22CoN2O4 and a molecular weight of 485.41 g/mol. Its IUPAC name is cobalt;bis(diphenylcarbamic acid).

Molecular Properties

Compound Namecobalt;bis(diphenylcarbamic acid)
PubChem CID155679078
Molecular FormulaC26H22CoN2O4
Molecular Weight485.41 g/mol
Exact Mass485.09
IUPAC Namecobalt;bis(diphenylcarbamic acid)
SMILESO=C(O)N(c1ccccc1)c1ccccc1.O=C(O)N(c1ccccc1)c1ccccc1.[Co]
InChIInChI=1S/2C13H11NO2.Co/c2*15-13(16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h2*1-10H,(H,15,16);
InChIKeyRYRTYJTVYGOIGH-UHFFFAOYSA-N
XLogP7.00
TPSA81.08 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms33
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500485.41
LogP ≤ 57.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cobalt;bis(diphenylcarbamic acid) with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(4-methylphenyl)-[4-(N-(4-methylphenyl)anilino)phenyl]carbamic acid
CID 67427194
1,1-diphenylurea
CID 174849888
(5-methyl-3-pyridinyl)-phenylcarbamic acid
CID 66885167
N-[4-(N-acetylanilino)phenyl]-N-phenylacetamide
CID 14470893
(3-methyl-5-phenylphenyl)-phenylcarbamic acid
CID 59842791
butane;1,1-diphenylurea
CID 70397101
phenyl-[2-(trifluoromethyl)phenyl]carbamic acid
CID 66619011
[3-fluoro-5-(trifluoromethyl)phenyl]-phenylcarbamic acid
CID 71129201
2-(N-carboxyanilino)-2-oxoacetic acid
CID 69036482
phenyl-(2-phenylsulfanylphenyl)carbamic acid
CID 69355896
(4-cyano-3-methylphenyl)-phenylcarbamic acid
CID 126683768
[4,6-bis(dimethylamino)pyrimidin-2-yl]-phenylcarbamic acid
CID 67693508

Frequently Asked Questions

What is the IUPAC name of cobalt;bis(diphenylcarbamic acid)?
The IUPAC name of cobalt;bis(diphenylcarbamic acid) (CID 155679078) is cobalt;bis(diphenylcarbamic acid).
What is the SMILES notation for cobalt;bis(diphenylcarbamic acid)?
The canonical SMILES for cobalt;bis(diphenylcarbamic acid) is O=C(O)N(c1ccccc1)c1ccccc1.O=C(O)N(c1ccccc1)c1ccccc1.[Co].
What is the InChIKey of cobalt;bis(diphenylcarbamic acid)?
The InChIKey is RYRTYJTVYGOIGH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H11NO2.Co/c2*15-13(16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h2*1-10H,(H,15,16);.
What are the key properties of cobalt;bis(diphenylcarbamic acid)?
cobalt;bis(diphenylcarbamic acid) has a molecular weight of 485.41 g/mol, XLogP of 7.00, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(diphenylcarbamic acid) is sourced from PubChem (CID 155679078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).