C26H24N4O2 — CID 174849888
1,1-diphenylurea (PubChem CID 174849888) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 1,1-diphenylurea.
| Compound Name | 1,1-diphenylurea |
|---|---|
| PubChem CID | 174849888 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1,1-diphenylurea |
| SMILES | NC(=O)N(c1ccccc1)c1ccccc1.NC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C13H12N2O/c2*14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2*1-10H,(H2,14,16) |
| InChIKey | BRAMQJCATURHEZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |