C13H11Br2ClN2O — CID 172731667
1,1-bis(4-bromophenyl)urea;hydrochloride (PubChem CID 172731667) has the molecular formula C13H11Br2ClN2O and a molecular weight of 406.51 g/mol. Its IUPAC name is 1,1-bis(4-bromophenyl)urea;hydrochloride.
| Compound Name | 1,1-bis(4-bromophenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 172731667 |
| Molecular Formula | C13H11Br2ClN2O |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | 1,1-bis(4-bromophenyl)urea;hydrochloride |
| SMILES | Cl.NC(=O)N(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H10Br2N2O.ClH/c14-9-1-5-11(6-2-9)17(13(16)18)12-7-3-10(15)4-8-12;/h1-8H,(H2,16,18);1H |
| InChIKey | HWMBWEFSTFJHNU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |