C9H9BrF2N2O — CID 175715890
N-(4-bromophenyl)-3,3-difluoropropanehydrazide (PubChem CID 175715890) has the molecular formula C9H9BrF2N2O and a molecular weight of 279.08 g/mol. Its IUPAC name is N-(4-bromophenyl)-3,3-difluoropropanehydrazide.
| Compound Name | N-(4-bromophenyl)-3,3-difluoropropanehydrazide |
|---|---|
| PubChem CID | 175715890 |
| Molecular Formula | C9H9BrF2N2O |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | N-(4-bromophenyl)-3,3-difluoropropanehydrazide |
| SMILES | NN(C(=O)CC(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H9BrF2N2O/c10-6-1-3-7(4-2-6)14(13)9(15)5-8(11)12/h1-4,8H,5,13H2 |
| InChIKey | SBONPAKXTPVZFB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|