C10H10BrF2NO — CID 115611577
4-bromo-N-(2,2-difluoroethyl)-N-methylbenzamide (PubChem CID 115611577) has the molecular formula C10H10BrF2NO and a molecular weight of 278.10 g/mol. Its IUPAC name is 4-bromo-N-(2,2-difluoroethyl)-N-methylbenzamide.
| Compound Name | 4-bromo-N-(2,2-difluoroethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 115611577 |
| Molecular Formula | C10H10BrF2NO |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 4-bromo-N-(2,2-difluoroethyl)-N-methylbenzamide |
| SMILES | CN(CC(F)F)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H10BrF2NO/c1-14(6-9(12)13)10(15)7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3 |
| InChIKey | BODFPQMOTZFMDK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |