C12H13BrF2N2O2 — CID 99699977
4-bromo-N-[2-[2,2-difluoroethyl(methyl)amino]-2-oxoethyl]benzamide (PubChem CID 99699977) has the molecular formula C12H13BrF2N2O2 and a molecular weight of 335.15 g/mol. Its IUPAC name is 4-bromo-N-[2-[2,2-difluoroethyl(methyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[2,2-difluoroethyl(methyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 99699977 |
| Molecular Formula | C12H13BrF2N2O2 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 4-bromo-N-[2-[2,2-difluoroethyl(methyl)amino]-2-oxoethyl]benzamide |
| SMILES | CN(CC(F)F)C(=O)CNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrF2N2O2/c1-17(7-10(14)15)11(18)6-16-12(19)8-2-4-9(13)5-3-8/h2-5,10H,6-7H2,1H3,(H,16,19) |
| InChIKey | AHKIRLWNMOCNAG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |