C13H15F2N3O4 — CID 100683029
N-[2-[2,2-difluoroethyl(methyl)amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide (PubChem CID 100683029) has the molecular formula C13H15F2N3O4 and a molecular weight of 315.28 g/mol. Its IUPAC name is N-[2-[2,2-difluoroethyl(methyl)amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[2-[2,2-difluoroethyl(methyl)amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 100683029 |
| Molecular Formula | C13H15F2N3O4 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-[2-[2,2-difluoroethyl(methyl)amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NCC(=O)N(C)CC(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15F2N3O4/c1-8-5-9(3-4-10(8)18(21)22)13(20)16-6-12(19)17(2)7-11(14)15/h3-5,11H,6-7H2,1-2H3,(H,16,20) |
| InChIKey | KBIMLQYCRLYMMQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|