C22H25N3O6 — CID 26373217
N-[2-[[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide (PubChem CID 26373217) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[2-[[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[2-[[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 26373217 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[2-[[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NCC(=O)N[C@H](c2ccc3c(c2)OCCO3)C(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N3O6/c1-13(2)21(15-5-7-18-19(11-15)31-9-8-30-18)24-20(26)12-23-22(27)16-4-6-17(25(28)29)14(3)10-16/h4-7,10-11,13,21H,8-9,12H2,1-3H3,(H,23,27)(H,24,26)/t21-/m0/s1 |
| InChIKey | AWBCUVDNRHKDEG-NRFANRHFSA-N |
| XLogP | 2.92 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|