C21H24N2O5 — CID 16960350
N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-4-methyl-3-nitrobenzamide (PubChem CID 16960350) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 16960350 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NC(c2ccc3c(c2)OCCCO3)C(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N2O5/c1-13(2)20(15-7-8-18-19(12-15)28-10-4-9-27-18)22-21(24)16-6-5-14(3)17(11-16)23(25)26/h5-8,11-13,20H,4,9-10H2,1-3H3,(H,22,24) |
| InChIKey | RITABAXTWQUMSZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|