C19H19FN2O5 — CID 9258491
N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-4-fluoro-3-nitrobenzamide (PubChem CID 9258491) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-4-fluoro-3-nitrobenzamide.
| Compound Name | N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-4-fluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 9258491 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-4-fluoro-3-nitrobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(F)c([N+](=O)[O-])c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H19FN2O5/c1-11(2)18(12-4-6-16-17(10-12)27-8-7-26-16)21-19(23)13-3-5-14(20)15(9-13)22(24)25/h3-6,9-11,18H,7-8H2,1-2H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | QDLPIYVSQWPGJN-SFHVURJKSA-N |
| XLogP | 3.63 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|