C19H19ClN2O5 — CID 9257723
4-chloro-N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2-nitrobenzamide (PubChem CID 9257723) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2-nitrobenzamide.
| Compound Name | 4-chloro-N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 9257723 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 4-chloro-N-[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-2-nitrobenzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(Cl)cc1[N+](=O)[O-])c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H19ClN2O5/c1-11(2)18(12-3-6-16-17(9-12)27-8-7-26-16)21-19(23)14-5-4-13(20)10-15(14)22(24)25/h3-6,9-11,18H,7-8H2,1-2H3,(H,21,23)/t18-/m1/s1 |
| InChIKey | KIUCOMZMKAIHEP-GOSISDBHSA-N |
| XLogP | 4.15 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|