C13H17F2N3O3 — CID 107479272
4-amino-N-[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2-oxoethyl]benzamide (PubChem CID 107479272) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is 4-amino-N-[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-amino-N-[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 107479272 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-amino-N-[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2-oxoethyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCC(=O)N(CCO)CC(F)F)cc1 |
| InChI | InChI=1S/C13H17F2N3O3/c14-11(15)8-18(5-6-19)12(20)7-17-13(21)9-1-3-10(16)4-2-9/h1-4,11,19H,5-8,16H2,(H,17,21) |
| InChIKey | RCUAQXJMKWYLKD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|