C14H18F2N2O2 — CID 107479302
1-(4-aminophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)cyclopropane-1-carboxamide (PubChem CID 107479302) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 107479302 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(4-aminophenyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)cyclopropane-1-carboxamide |
| SMILES | Nc1ccc(C2(C(=O)N(CCO)CC(F)F)CC2)cc1 |
| InChI | InChI=1S/C14H18F2N2O2/c15-12(16)9-18(7-8-19)13(20)14(5-6-14)10-1-3-11(17)4-2-10/h1-4,12,19H,5-9,17H2 |
| InChIKey | FLOLSCOKTKVSHI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|