C14H20N2O3 — CID 112558286
1-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)cyclopropane-1-carboxamide (PubChem CID 112558286) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 112558286 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)cyclopropane-1-carboxamide |
| SMILES | Nc1ccc(C2(C(=O)N(CCO)CCO)CC2)cc1 |
| InChI | InChI=1S/C14H20N2O3/c15-12-3-1-11(2-4-12)14(5-6-14)13(19)16(7-9-17)8-10-18/h1-4,17-18H,5-10,15H2 |
| InChIKey | COKCZNDSMNOGMB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|